![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. Dr. Jayatheertha S. Lokapur - Introduction to dosage forms.mp4 | 2024-01-18 03:37 | 35M | |
| 2. Dr. Jayatheertha S Lokapur-Artificial Intelligence in Pharmacy.mp4 | 2024-01-18 03:41 | 37M | |
| BP Sathishkumar- Pharmaceutics care concept.MOV | 2024-01-18 07:46 | 1.0G | |
| Dr.Bharathi. DR- Neurotransmission.mp4 | 2024-01-12 09:02 | 70M | |
| Dr.Bharathi.DR-Pharmokinetics of drug Interaction.mp4 | 2024-01-12 09:15 | 57M | |
| Dr.M.Shankar- CATALYSIS.mp4 | 2024-01-18 09:31 | 170M | |
| Dr.M.Shankar Isomerism.mp4 | 2024-01-18 09:33 | 38M | |
| Dr.N.Raghavendra Naveen-QbD in Pharmaceutical formn..mp4 | 2024-01-17 07:17 | 197M | |
| Dr.N.Raghavendra Naveen-SIZE REDUCTION.mp4 | 2024-01-17 07:30 | 74M | |
| Dr.Robin George- case report and case series.mp4 | 2024-01-20 06:20 | 10M | |
| Dr Abhishek B V- Common Technical document.mp4 | 2024-01-18 05:00 | 78M | |
| chandana - Chemotherapy.mp4 | 2024-01-12 10:34 | 19M | |